C9H14F4N6OP+ — CID 20812321
[1,2-dihydrotriazolo[4,5-b]pyridin-3-yloxy-[methyl-(tetrafluoro-λ5-phosphanyl)amino]methylidene]-dimethylazanium (PubChem CID 20812321) has the molecular formula C9H14F4N6OP+ and a molecular weight of 329.22 g/mol. Its IUPAC name is [1,2-dihydrotriazolo[4,5-b]pyridin-3-yloxy-[methyl-(tetrafluoro-λ5-phosphanyl)amino]methylidene]-dimethylazanium.
| Compound Name | [1,2-dihydrotriazolo[4,5-b]pyridin-3-yloxy-[methyl-(tetrafluoro-λ5-phosphanyl)amino]methylidene]-dimethylazanium |
|---|---|
| PubChem CID | 20812321 |
| Molecular Formula | C9H14F4N6OP+ |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [1,2-dihydrotriazolo[4,5-b]pyridin-3-yloxy-[methyl-(tetrafluoro-λ5-phosphanyl)amino]methylidene]-dimethylazanium |
| SMILES | CN(C(ON1NNc2cccnc21)=[N+](C)C)P(F)(F)(F)F |
| InChI | InChI=1S/C9H14F4N6OP/c1-17(2)9(18(3)21(10,11,12)13)20-19-8-7(15-16-19)5-4-6-14-8/h4-6,15-16H,1-3H3/q+1 |
| InChIKey | QSNXUDBBGNEVTM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|