C11H16N4OS+2 — CID 172848354
[dimethylamino([1,3]thiazolo[5,4-b]pyridin-3-ium-3-yloxy)methylidene]-dimethylazanium (PubChem CID 172848354) has the molecular formula C11H16N4OS+2 and a molecular weight of 252.34 g/mol. Its IUPAC name is [dimethylamino([1,3]thiazolo[5,4-b]pyridin-3-ium-3-yloxy)methylidene]-dimethylazanium.
| Compound Name | [dimethylamino([1,3]thiazolo[5,4-b]pyridin-3-ium-3-yloxy)methylidene]-dimethylazanium |
|---|---|
| PubChem CID | 172848354 |
| Molecular Formula | C11H16N4OS+2 |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [dimethylamino([1,3]thiazolo[5,4-b]pyridin-3-ium-3-yloxy)methylidene]-dimethylazanium |
| SMILES | CN(C)C(O[s+]1cnc2cccnc21)=[N+](C)C |
| InChI | InChI=1S/C11H16N4OS/c1-14(2)11(15(3)4)16-17-8-13-9-6-5-7-12-10(9)17/h5-8H,1-4H3/q+2 |
| InChIKey | XSPZIZMQENAZQY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 41.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|