C29H26O7 — CID 58773881
[4-[4-(2-oxobut-3-enoxy)benzoyl]phenyl] 4-(3-ethenoxypropoxy)benzoate (PubChem CID 58773881) has the molecular formula C29H26O7 and a molecular weight of 486.52 g/mol. Its IUPAC name is [4-[4-(2-oxobut-3-enoxy)benzoyl]phenyl] 4-(3-ethenoxypropoxy)benzoate.
| Compound Name | [4-[4-(2-oxobut-3-enoxy)benzoyl]phenyl] 4-(3-ethenoxypropoxy)benzoate |
|---|---|
| PubChem CID | 58773881 |
| Molecular Formula | C29H26O7 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | [4-[4-(2-oxobut-3-enoxy)benzoyl]phenyl] 4-(3-ethenoxypropoxy)benzoate |
| SMILES | C=COCCCOc1ccc(C(=O)Oc2ccc(C(=O)c3ccc(OCC(=O)C=C)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H26O7/c1-3-24(30)20-35-26-12-6-21(7-13-26)28(31)22-8-16-27(17-9-22)36-29(32)23-10-14-25(15-11-23)34-19-5-18-33-4-2/h3-4,6-17H,1-2,5,18-20H2 |
| InChIKey | PXPZHXPXQOMBMA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|