C15H17N3O4 — CID 58777768
3-[4-[(5S)-5-[(methylideneamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1,3-oxazinan-2-one (PubChem CID 58777768) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 3-[4-[(5S)-5-[(methylideneamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1,3-oxazinan-2-one.
| Compound Name | 3-[4-[(5S)-5-[(methylideneamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 58777768 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 3-[4-[(5S)-5-[(methylideneamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1,3-oxazinan-2-one |
| SMILES | C=NC[C@H]1CN(c2ccc(N3CCCOC3=O)cc2)C(=O)O1 |
| InChI | InChI=1S/C15H17N3O4/c1-16-9-13-10-18(15(20)22-13)12-5-3-11(4-6-12)17-7-2-8-21-14(17)19/h3-6,13H,1-2,7-10H2/t13-/m0/s1 |
| InChIKey | QZMSPHMTDNKGQE-ZDUSSCGKSA-N |
| XLogP | 2.06 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|