C12H21O4S+ — CID 58779943
diethyl-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-2-oxoethyl]sulfanium (PubChem CID 58779943) has the molecular formula C12H21O4S+ and a molecular weight of 261.36 g/mol. Its IUPAC name is diethyl-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-2-oxoethyl]sulfanium.
| Compound Name | diethyl-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-2-oxoethyl]sulfanium |
|---|---|
| PubChem CID | 58779943 |
| Molecular Formula | C12H21O4S+ |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | diethyl-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-2-oxoethyl]sulfanium |
| SMILES | C=C(C)C(=O)OCCOC(=O)C[S+](CC)CC |
| InChI | InChI=1S/C12H21O4S/c1-5-17(6-2)9-11(13)15-7-8-16-12(14)10(3)4/h3,5-9H2,1-2,4H3/q+1 |
| InChIKey | PVUFCLSPZCJDRW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|