C17H31O4S+ — CID 58779963
dibutyl-[2-[1-(2-methylprop-2-enoyloxy)propan-2-yloxy]-2-oxoethyl]sulfanium (PubChem CID 58779963) has the molecular formula C17H31O4S+ and a molecular weight of 331.50 g/mol. Its IUPAC name is dibutyl-[2-[1-(2-methylprop-2-enoyloxy)propan-2-yloxy]-2-oxoethyl]sulfanium.
| Compound Name | dibutyl-[2-[1-(2-methylprop-2-enoyloxy)propan-2-yloxy]-2-oxoethyl]sulfanium |
|---|---|
| PubChem CID | 58779963 |
| Molecular Formula | C17H31O4S+ |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | dibutyl-[2-[1-(2-methylprop-2-enoyloxy)propan-2-yloxy]-2-oxoethyl]sulfanium |
| SMILES | C=C(C)C(=O)OCC(C)OC(=O)C[S+](CCCC)CCCC |
| InChI | InChI=1S/C17H31O4S/c1-6-8-10-22(11-9-7-2)13-16(18)21-15(5)12-20-17(19)14(3)4/h15H,3,6-13H2,1-2,4-5H3/q+1 |
| InChIKey | OHQIMVXDQWKVCE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|