C8H8O6 — CID 58789578
methyl (3,4,5-trihydroxyphenyl) carbonate (PubChem CID 58789578) has the molecular formula C8H8O6 and a molecular weight of 200.15 g/mol. Its IUPAC name is methyl (3,4,5-trihydroxyphenyl) carbonate.
| Compound Name | methyl (3,4,5-trihydroxyphenyl) carbonate |
|---|---|
| PubChem CID | 58789578 |
| Molecular Formula | C8H8O6 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | methyl (3,4,5-trihydroxyphenyl) carbonate |
| SMILES | COC(=O)Oc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C8H8O6/c1-13-8(12)14-4-2-5(9)7(11)6(10)3-4/h2-3,9-11H,1H3 |
| InChIKey | PRDKUQQBJZQHBS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|