C25H22N5NaO3S2 — CID 58789646
sodium 2-[3-[[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenoxy]methylamino]phenyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 58789646) has the molecular formula C25H22N5NaO3S2 and a molecular weight of 527.61 g/mol. Its IUPAC name is sodium 2-[3-[[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenoxy]methylamino]phenyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | sodium 2-[3-[[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenoxy]methylamino]phenyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 58789646 |
| Molecular Formula | C25H22N5NaO3S2 |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | sodium 2-[3-[[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenoxy]methylamino]phenyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | O=C([O-])C1Cc2ccccc2CN1c1cccc(NCOc2ccc(-n3c(=S)[nH][nH]c3=S)cc2)c1.[Na+] |
| InChI | InChI=1S/C25H23N5O3S2.Na/c31-23(32)22-12-16-4-1-2-5-17(16)14-29(22)20-7-3-6-18(13-20)26-15-33-21-10-8-19(9-11-21)30-24(34)27-28-25(30)35;/h1-11,13,22,26H,12,14-15H2,(H,27,34)(H,28,35)(H,31,32);/q;+1/p-1 |
| InChIKey | IDKRICNOEHGBPL-UHFFFAOYSA-M |
| XLogP | 0.73 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|