C21H21N5O3S2 — CID 20615734
1-[3-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]anilino]methoxy]phenyl]-3,6-dihydro-2H-pyridine-2-carboxylic acid (PubChem CID 20615734) has the molecular formula C21H21N5O3S2 and a molecular weight of 455.57 g/mol. Its IUPAC name is 1-[3-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]anilino]methoxy]phenyl]-3,6-dihydro-2H-pyridine-2-carboxylic acid.
| Compound Name | 1-[3-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]anilino]methoxy]phenyl]-3,6-dihydro-2H-pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 20615734 |
| Molecular Formula | C21H21N5O3S2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 1-[3-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]anilino]methoxy]phenyl]-3,6-dihydro-2H-pyridine-2-carboxylic acid |
| SMILES | O=C(O)C1CC=CCN1c1cccc(OCNc2cccc(-n3c(=S)[nH][nH]c3=S)c2)c1 |
| InChI | InChI=1S/C21H21N5O3S2/c27-19(28)18-9-1-2-10-25(18)15-6-4-8-17(12-15)29-13-22-14-5-3-7-16(11-14)26-20(30)23-24-21(26)31/h1-8,11-12,18,22H,9-10,13H2,(H,23,30)(H,24,31)(H,27,28) |
| InChIKey | TZESFAHXGIZYRD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|