C17H23Cl2NO2 — CID 587923
2-(5-ethyl-2-methylpiperidin-1-yl)ethyl 3,5-dichlorobenzoate (PubChem CID 587923) has the molecular formula C17H23Cl2NO2 and a molecular weight of 344.28 g/mol. Its IUPAC name is 2-(5-ethyl-2-methylpiperidin-1-yl)ethyl 3,5-dichlorobenzoate.
| Compound Name | 2-(5-ethyl-2-methylpiperidin-1-yl)ethyl 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 587923 |
| Molecular Formula | C17H23Cl2NO2 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-(5-ethyl-2-methylpiperidin-1-yl)ethyl 3,5-dichlorobenzoate |
| SMILES | CCC1CCC(C)N(CCOC(=O)c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C17H23Cl2NO2/c1-3-13-5-4-12(2)20(11-13)6-7-22-17(21)14-8-15(18)10-16(19)9-14/h8-10,12-13H,3-7,11H2,1-2H3 |
| InChIKey | LCYMMAFVXPNSOC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |