C15H18ClF2NO2 — CID 87723814
ethyl 3-chloro-5-[1-(2,2-difluoroethyl)pyrrolidin-3-yl]benzoate (PubChem CID 87723814) has the molecular formula C15H18ClF2NO2 and a molecular weight of 317.76 g/mol. Its IUPAC name is ethyl 3-chloro-5-[1-(2,2-difluoroethyl)pyrrolidin-3-yl]benzoate.
| Compound Name | ethyl 3-chloro-5-[1-(2,2-difluoroethyl)pyrrolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 87723814 |
| Molecular Formula | C15H18ClF2NO2 |
| Molecular Weight | 317.76 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | ethyl 3-chloro-5-[1-(2,2-difluoroethyl)pyrrolidin-3-yl]benzoate |
| SMILES | CCOC(=O)c1cc(Cl)cc(C2CCN(CC(F)F)C2)c1 |
| InChI | InChI=1S/C15H18ClF2NO2/c1-2-21-15(20)12-5-11(6-13(16)7-12)10-3-4-19(8-10)9-14(17)18/h5-7,10,14H,2-4,8-9H2,1H3 |
| InChIKey | OKMKATIFUSBKKY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |