C43H34F6IrN4-2 — CID 58793154
iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine;2-N',2-N',7-N',7-N'-tetramethyl-6-pyridin-2-ylspiro[3,5-dihydro-1H-inden-5-ide-2,9'-fluorene]-2',7'-diamine (PubChem CID 58793154) has the molecular formula C43H34F6IrN4-2 and a molecular weight of 912.98 g/mol. Its IUPAC name is iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine;2-N',2-N',7-N',7-N'-tetramethyl-6-pyridin-2-ylspiro[3,5-dihydro-1H-inden-5-ide-2,9'-fluorene]-2',7'-diamine.
| Compound Name | iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine;2-N',2-N',7-N',7-N'-tetramethyl-6-pyridin-2-ylspiro[3,5-dihydro-1H-inden-5-ide-2,9'-fluorene]-2',7'-diamine |
|---|---|
| PubChem CID | 58793154 |
| Molecular Formula | C43H34F6IrN4-2 |
| Molecular Weight | 912.98 g/mol |
| Exact Mass | 913.23 |
| IUPAC Name | iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine;2-N',2-N',7-N',7-N'-tetramethyl-6-pyridin-2-ylspiro[3,5-dihydro-1H-inden-5-ide-2,9'-fluorene]-2',7'-diamine |
| SMILES | CN(C)c1ccc2c(c1)C1(Cc3c[c-]c(-c4ccccn4)cc3C1)c1cc(N(C)C)ccc1-2.FC(F)(F)c1cc(-c2[c-]cccc2)nc(C(F)(F)F)c1.[Ir] |
| InChI | InChI=1S/C30H28N3.C13H6F6N.Ir/c1-32(2)23-10-12-25-26-13-11-24(33(3)4)17-28(26)30(27(25)16-23)18-21-9-8-20(15-22(21)19-30)29-7-5-6-14-31-29;14-12(15,16)9-6-10(8-4-2-1-3-5-8)20-11(7-9)13(17,18)19;/h5-7,9-17H,18-19H2,1-4H3;1-4,6-7H;/q2*-1; |
| InChIKey | BXHLAJJDTVRJMZ-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.98 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|