C22H24N6OS — CID 58801443
N-cyclohexyl-3-[12-methyl-8-(methylamino)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-4-yl]benzamide (PubChem CID 58801443) has the molecular formula C22H24N6OS and a molecular weight of 420.54 g/mol. Its IUPAC name is N-cyclohexyl-3-[12-methyl-8-(methylamino)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-4-yl]benzamide.
| Compound Name | N-cyclohexyl-3-[12-methyl-8-(methylamino)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-4-yl]benzamide |
|---|---|
| PubChem CID | 58801443 |
| Molecular Formula | C22H24N6OS |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-cyclohexyl-3-[12-methyl-8-(methylamino)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-4-yl]benzamide |
| SMILES | CNc1nc2sc(-c3cccc(C(=O)NC4CCCCC4)c3)nc2c2c1ncn2C |
| InChI | InChI=1S/C22H24N6OS/c1-23-19-16-18(28(2)12-24-16)17-22(27-19)30-21(26-17)14-8-6-7-13(11-14)20(29)25-15-9-4-3-5-10-15/h6-8,11-12,15H,3-5,9-10H2,1-2H3,(H,23,27)(H,25,29) |
| InChIKey | JPTCULONIPHNBN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |