C21H22N6O2 — CID 67526822
[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl N-cyclopropylcarbamate (PubChem CID 67526822) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is [3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl N-cyclopropylcarbamate.
| Compound Name | [3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 67526822 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | [3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl N-cyclopropylcarbamate |
| SMILES | CNc1nc2[nH]c(-c3cccc(COC(=O)NC4CC4)c3)cc2c2c1ncn2C |
| InChI | InChI=1S/C21H22N6O2/c1-22-20-17-18(27(2)11-23-17)15-9-16(25-19(15)26-20)13-5-3-4-12(8-13)10-29-21(28)24-14-6-7-14/h3-5,8-9,11,14H,6-7,10H2,1-2H3,(H,24,28)(H2,22,25,26) |
| InChIKey | GTNHKELLIYPGSM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |