C22H24N6O3 — CID 91356476
ethyl 3-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]benzoyl]amino]propanoate (PubChem CID 91356476) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is ethyl 3-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]benzoyl]amino]propanoate.
| Compound Name | ethyl 3-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 91356476 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | ethyl 3-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]benzoyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)c1cccc(-c2cc3c(nc(NC)c4ncn(C)c43)[nH]2)c1 |
| InChI | InChI=1S/C22H24N6O3/c1-4-31-17(29)8-9-24-22(30)14-7-5-6-13(10-14)16-11-15-19-18(25-12-28(19)3)21(23-2)27-20(15)26-16/h5-7,10-12H,4,8-9H2,1-3H3,(H,24,30)(H2,23,26,27) |
| InChIKey | LSMUZOFIFROCHO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |