C22H20N8O — CID 67526813
N-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]pyrazine-2-carboxamide (PubChem CID 67526813) has the molecular formula C22H20N8O and a molecular weight of 412.46 g/mol. Its IUPAC name is N-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]pyrazine-2-carboxamide.
| Compound Name | N-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 67526813 |
| Molecular Formula | C22H20N8O |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]pyrazine-2-carboxamide |
| SMILES | CNc1nc2[nH]c(-c3cccc(CNC(=O)c4cnccn4)c3)cc2c2c1ncn2C |
| InChI | InChI=1S/C22H20N8O/c1-23-21-18-19(30(2)12-27-18)15-9-16(28-20(15)29-21)14-5-3-4-13(8-14)10-26-22(31)17-11-24-6-7-25-17/h3-9,11-12H,10H2,1-2H3,(H,26,31)(H2,23,28,29) |
| InChIKey | ZLNDECYDEDTZPU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |