C24H23N7O — CID 67527495
1-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]-3-phenylurea (PubChem CID 67527495) has the molecular formula C24H23N7O and a molecular weight of 425.50 g/mol. Its IUPAC name is 1-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]-3-phenylurea.
| Compound Name | 1-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 67527495 |
| Molecular Formula | C24H23N7O |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 1-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]-3-phenylurea |
| SMILES | CNc1nc2[nH]c(-c3cccc(CNC(=O)Nc4ccccc4)c3)cc2c2c1ncn2C |
| InChI | InChI=1S/C24H23N7O/c1-25-23-20-21(31(2)14-27-20)18-12-19(29-22(18)30-23)16-8-6-7-15(11-16)13-26-24(32)28-17-9-4-3-5-10-17/h3-12,14H,13H2,1-2H3,(H2,25,29,30)(H2,26,28,32) |
| InChIKey | FZZQETMMJOTXKC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |