C28H29N7O2 — CID 67526785
[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl 4-phenylpiperazine-1-carboxylate (PubChem CID 67526785) has the molecular formula C28H29N7O2 and a molecular weight of 495.59 g/mol. Its IUPAC name is [3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl 4-phenylpiperazine-1-carboxylate.
| Compound Name | [3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl 4-phenylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 67526785 |
| Molecular Formula | C28H29N7O2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | [3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl 4-phenylpiperazine-1-carboxylate |
| SMILES | CNc1nc2[nH]c(-c3cccc(COC(=O)N4CCN(c5ccccc5)CC4)c3)cc2c2c1ncn2C |
| InChI | InChI=1S/C28H29N7O2/c1-29-27-24-25(33(2)18-30-24)22-16-23(31-26(22)32-27)20-8-6-7-19(15-20)17-37-28(36)35-13-11-34(12-14-35)21-9-4-3-5-10-21/h3-10,15-16,18H,11-14,17H2,1-2H3,(H2,29,31,32) |
| InChIKey | KDZOGDDDCAELTI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |