C22H27N7O — CID 67527446
1-tert-butyl-3-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]urea (PubChem CID 67527446) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is 1-tert-butyl-3-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]urea.
| Compound Name | 1-tert-butyl-3-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 67527446 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 1-tert-butyl-3-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]urea |
| SMILES | CNc1nc2[nH]c(-c3cccc(CNC(=O)NC(C)(C)C)c3)cc2c2c1ncn2C |
| InChI | InChI=1S/C22H27N7O/c1-22(2,3)28-21(30)24-11-13-7-6-8-14(9-13)16-10-15-18-17(25-12-29(18)5)20(23-4)27-19(15)26-16/h6-10,12H,11H2,1-5H3,(H2,23,26,27)(H2,24,28,30) |
| InChIKey | ARHSOLAQFILIEL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |