C28H40F12O4 — CID 58820944
[1,1,1,3,3,3-hexafluoro-2-[3-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]cyclohexyl]propan-2-yl] 2-methylbutanoate (PubChem CID 58820944) has the molecular formula C28H40F12O4 and a molecular weight of 668.60 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[3-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]cyclohexyl]propan-2-yl] 2-methylbutanoate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[3-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]cyclohexyl]propan-2-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 58820944 |
| Molecular Formula | C28H40F12O4 |
| Molecular Weight | 668.60 g/mol |
| Exact Mass | 668.27 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[3-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]cyclohexyl]propan-2-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC(C1CCCC(C(OCOC2CC(C)CCC2C(C)C)(C(F)(F)F)C(F)(F)F)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C28H40F12O4/c1-6-17(5)22(41)44-24(27(35,36)37,28(38,39)40)19-9-7-8-18(13-19)23(25(29,30)31,26(32,33)34)43-14-42-21-12-16(4)10-11-20(21)15(2)3/h15-21H,6-14H2,1-5H3 |
| InChIKey | RUVWFQWSHVQDIE-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.60 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|