C27H27NO4 — CID 58831299
[4-(N-phenylanilino)phenyl] 6-hydroxy-7-oxonon-8-enoate (PubChem CID 58831299) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is [4-(N-phenylanilino)phenyl] 6-hydroxy-7-oxonon-8-enoate.
| Compound Name | [4-(N-phenylanilino)phenyl] 6-hydroxy-7-oxonon-8-enoate |
|---|---|
| PubChem CID | 58831299 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [4-(N-phenylanilino)phenyl] 6-hydroxy-7-oxonon-8-enoate |
| SMILES | C=CC(=O)C(O)CCCCC(=O)Oc1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H27NO4/c1-2-25(29)26(30)15-9-10-16-27(31)32-24-19-17-23(18-20-24)28(21-11-5-3-6-12-21)22-13-7-4-8-14-22/h2-8,11-14,17-20,26,30H,1,9-10,15-16H2 |
| InChIKey | JTNIQOZPJYNAAE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|