C28H35ClN4O — CID 58836861
6-[2-(4-chlorophenyl)-2-(4-cyclohexylpiperazin-1-yl)ethyl]-3-ethyl-1H-quinoxalin-2-one (PubChem CID 58836861) has the molecular formula C28H35ClN4O and a molecular weight of 479.07 g/mol. Its IUPAC name is 6-[2-(4-chlorophenyl)-2-(4-cyclohexylpiperazin-1-yl)ethyl]-3-ethyl-1H-quinoxalin-2-one.
| Compound Name | 6-[2-(4-chlorophenyl)-2-(4-cyclohexylpiperazin-1-yl)ethyl]-3-ethyl-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 58836861 |
| Molecular Formula | C28H35ClN4O |
| Molecular Weight | 479.07 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 6-[2-(4-chlorophenyl)-2-(4-cyclohexylpiperazin-1-yl)ethyl]-3-ethyl-1H-quinoxalin-2-one |
| SMILES | CCc1nc2cc(CC(c3ccc(Cl)cc3)N3CCN(C4CCCCC4)CC3)ccc2[nH]c1=O |
| InChI | InChI=1S/C28H35ClN4O/c1-2-24-28(34)31-25-13-8-20(18-26(25)30-24)19-27(21-9-11-22(29)12-10-21)33-16-14-32(15-17-33)23-6-4-3-5-7-23/h8-13,18,23,27H,2-7,14-17,19H2,1H3,(H,31,34) |
| InChIKey | RIXHUIHIJXIQGR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.07 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |