C17H8ClF3N2O4S2 — CID 58837075
[5-(4-chlorophenyl)-6-oxo-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl] trifluoromethanesulfonate (PubChem CID 58837075) has the molecular formula C17H8ClF3N2O4S2 and a molecular weight of 460.84 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-6-oxo-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl] trifluoromethanesulfonate.
| Compound Name | [5-(4-chlorophenyl)-6-oxo-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58837075 |
| Molecular Formula | C17H8ClF3N2O4S2 |
| Molecular Weight | 460.84 g/mol |
| Exact Mass | 459.96 |
| IUPAC Name | [5-(4-chlorophenyl)-6-oxo-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl] trifluoromethanesulfonate |
| SMILES | O=c1c2sc3nccc(OS(=O)(=O)C(F)(F)F)c3c2ccn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H8ClF3N2O4S2/c18-9-1-3-10(4-2-9)23-8-6-11-13-12(27-29(25,26)17(19,20)21)5-7-22-15(13)28-14(11)16(23)24/h1-8H |
| InChIKey | VWVFTIRUALENEL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.84 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|