C18H11F3N2O5S2 — CID 58837088
[5-(4-methoxyphenyl)-6-oxo-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl] trifluoromethanesulfonate (PubChem CID 58837088) has the molecular formula C18H11F3N2O5S2 and a molecular weight of 456.42 g/mol. Its IUPAC name is [5-(4-methoxyphenyl)-6-oxo-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl] trifluoromethanesulfonate.
| Compound Name | [5-(4-methoxyphenyl)-6-oxo-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58837088 |
| Molecular Formula | C18H11F3N2O5S2 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | [5-(4-methoxyphenyl)-6-oxo-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(-n2ccc3c(sc4nccc(OS(=O)(=O)C(F)(F)F)c43)c2=O)cc1 |
| InChI | InChI=1S/C18H11F3N2O5S2/c1-27-11-4-2-10(3-5-11)23-9-7-12-14-13(28-30(25,26)18(19,20)21)6-8-22-16(14)29-15(12)17(23)24/h2-9H,1H3 |
| InChIKey | ZQCHDWOCDFDOTM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|