C19H18F4 — CID 58840072
2,2,4,4-tetradeuterio-8-fluoro-3-propyl-7-(3,4,5-trifluorophenyl)-1,3-dihydronaphthalene (PubChem CID 58840072) has the molecular formula C19H18F4 and a molecular weight of 326.37 g/mol. Its IUPAC name is 2,2,4,4-tetradeuterio-8-fluoro-3-propyl-7-(3,4,5-trifluorophenyl)-1,3-dihydronaphthalene.
| Compound Name | 2,2,4,4-tetradeuterio-8-fluoro-3-propyl-7-(3,4,5-trifluorophenyl)-1,3-dihydronaphthalene |
|---|---|
| PubChem CID | 58840072 |
| Molecular Formula | C19H18F4 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2,2,4,4-tetradeuterio-8-fluoro-3-propyl-7-(3,4,5-trifluorophenyl)-1,3-dihydronaphthalene |
| SMILES | [2H]C1([2H])Cc2c(ccc(-c3cc(F)c(F)c(F)c3)c2F)C([2H])([2H])C1CCC |
| InChI | InChI=1S/C19H18F4/c1-2-3-11-4-6-14-12(8-11)5-7-15(18(14)22)13-9-16(20)19(23)17(21)10-13/h5,7,9-11H,2-4,6,8H2,1H3/i4D2,8D2 |
| InChIKey | GOYKGBBRZPFDLD-ZDAGDFTFSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|