C12H22N2O3 — CID 58843355
tert-butyl (2R)-2-[[(2S)-1-oxopropan-2-yl]amino]-2-(prop-2-enylamino)acetate (PubChem CID 58843355) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[(2S)-1-oxopropan-2-yl]amino]-2-(prop-2-enylamino)acetate.
| Compound Name | tert-butyl (2R)-2-[[(2S)-1-oxopropan-2-yl]amino]-2-(prop-2-enylamino)acetate |
|---|---|
| PubChem CID | 58843355 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | tert-butyl (2R)-2-[[(2S)-1-oxopropan-2-yl]amino]-2-(prop-2-enylamino)acetate |
| SMILES | C=CCN[C@H](N[C@@H](C)C=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N2O3/c1-6-7-13-10(14-9(2)8-15)11(16)17-12(3,4)5/h6,8-10,13-14H,1,7H2,2-5H3/t9-,10+/m0/s1 |
| InChIKey | WALHJILZEFXTBI-VHSXEESVSA-N |
| XLogP | 0.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|