C20H32N2O5 — CID 58847382
2-(3,4-dimethoxyphenoxy)ethyl 4-pentan-3-ylpiperazine-1-carboxylate (PubChem CID 58847382) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenoxy)ethyl 4-pentan-3-ylpiperazine-1-carboxylate.
| Compound Name | 2-(3,4-dimethoxyphenoxy)ethyl 4-pentan-3-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 58847382 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 2-(3,4-dimethoxyphenoxy)ethyl 4-pentan-3-ylpiperazine-1-carboxylate |
| SMILES | CCC(CC)N1CCN(C(=O)OCCOc2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C20H32N2O5/c1-5-16(6-2)21-9-11-22(12-10-21)20(23)27-14-13-26-17-7-8-18(24-3)19(15-17)25-4/h7-8,15-16H,5-6,9-14H2,1-4H3 |
| InChIKey | WMZLVCSPMWVRIT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|