C20H32N6O2 — CID 58853446
tert-butyl N-[2-[[(1S)-3-(7-amino-3-ethylpyrazolo[1,5-a]pyrimidin-5-yl)cyclopentyl]amino]ethyl]carbamate (PubChem CID 58853446) has the molecular formula C20H32N6O2 and a molecular weight of 388.52 g/mol. Its IUPAC name is tert-butyl N-[2-[[(1S)-3-(7-amino-3-ethylpyrazolo[1,5-a]pyrimidin-5-yl)cyclopentyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(1S)-3-(7-amino-3-ethylpyrazolo[1,5-a]pyrimidin-5-yl)cyclopentyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 58853446 |
| Molecular Formula | C20H32N6O2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | tert-butyl N-[2-[[(1S)-3-(7-amino-3-ethylpyrazolo[1,5-a]pyrimidin-5-yl)cyclopentyl]amino]ethyl]carbamate |
| SMILES | CCc1cnn2c(N)cc(C3CC[C@H](NCCNC(=O)OC(C)(C)C)C3)nc12 |
| InChI | InChI=1S/C20H32N6O2/c1-5-13-12-24-26-17(21)11-16(25-18(13)26)14-6-7-15(10-14)22-8-9-23-19(27)28-20(2,3)4/h11-12,14-15,22H,5-10,21H2,1-4H3,(H,23,27)/t14?,15-/m0/s1 |
| InChIKey | AEJNHKRGUSHFIS-LOACHALJSA-N |
| XLogP | 2.62 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|