C23H32N2O11 — CID 58862831
bis(3-ethenoxypropyl) 2-[[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]amino]pentanedioate (PubChem CID 58862831) has the molecular formula C23H32N2O11 and a molecular weight of 512.51 g/mol. Its IUPAC name is bis(3-ethenoxypropyl) 2-[[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]amino]pentanedioate.
| Compound Name | bis(3-ethenoxypropyl) 2-[[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 58862831 |
| Molecular Formula | C23H32N2O11 |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | bis(3-ethenoxypropyl) 2-[[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]amino]pentanedioate |
| SMILES | C=COCCCOC(=O)CCC(NC(=O)CCC(=O)ON1C(=O)CCC1=O)C(=O)OCCCOC=C |
| InChI | InChI=1S/C23H32N2O11/c1-3-32-13-5-15-34-21(29)11-7-17(23(31)35-16-6-14-33-4-2)24-18(26)8-12-22(30)36-25-19(27)9-10-20(25)28/h3-4,17H,1-2,5-16H2,(H,24,26) |
| InChIKey | JGEHQJLSFMQSCP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 163.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|