C22H30N2O11 — CID 58862845
(2,5-dioxopyrrolidin-1-yl) 4-[bis[2-(3-ethenoxypropoxy)-2-oxoethyl]amino]-4-oxobutanoate (PubChem CID 58862845) has the molecular formula C22H30N2O11 and a molecular weight of 498.49 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[bis[2-(3-ethenoxypropoxy)-2-oxoethyl]amino]-4-oxobutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[bis[2-(3-ethenoxypropoxy)-2-oxoethyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 58862845 |
| Molecular Formula | C22H30N2O11 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[bis[2-(3-ethenoxypropoxy)-2-oxoethyl]amino]-4-oxobutanoate |
| SMILES | C=COCCCOC(=O)CN(CC(=O)OCCCOC=C)C(=O)CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C22H30N2O11/c1-3-31-11-5-13-33-21(29)15-23(16-22(30)34-14-6-12-32-4-2)17(25)9-10-20(28)35-24-18(26)7-8-19(24)27/h3-4H,1-2,5-16H2 |
| InChIKey | HLQORWRQLICZNQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 155.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|