C19H23F3NO4+ — CID 58866103
1-hydroxy-2-[2-methoxy-4-(trifluoromethoxy)phenyl]-3-methyl-5-pentan-3-yloxypyridin-1-ium (PubChem CID 58866103) has the molecular formula C19H23F3NO4+ and a molecular weight of 386.39 g/mol. Its IUPAC name is 1-hydroxy-2-[2-methoxy-4-(trifluoromethoxy)phenyl]-3-methyl-5-pentan-3-yloxypyridin-1-ium.
| Compound Name | 1-hydroxy-2-[2-methoxy-4-(trifluoromethoxy)phenyl]-3-methyl-5-pentan-3-yloxypyridin-1-ium |
|---|---|
| PubChem CID | 58866103 |
| Molecular Formula | C19H23F3NO4+ |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-hydroxy-2-[2-methoxy-4-(trifluoromethoxy)phenyl]-3-methyl-5-pentan-3-yloxypyridin-1-ium |
| SMILES | CCC(CC)Oc1cc(C)c(-c2ccc(OC(F)(F)F)cc2OC)[n+](O)c1 |
| InChI | InChI=1S/C19H23F3NO4/c1-5-13(6-2)26-15-9-12(3)18(23(24)11-15)16-8-7-14(10-17(16)25-4)27-19(20,21)22/h7-11,13,24H,5-6H2,1-4H3/q+1 |
| InChIKey | VZQLPWNIFPYFSH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|