C25H27N5O3 — CID 58867084
1-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3-[4-(2-nitrophenyl)phenyl]urea (PubChem CID 58867084) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3-[4-(2-nitrophenyl)phenyl]urea.
| Compound Name | 1-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3-[4-(2-nitrophenyl)phenyl]urea |
|---|---|
| PubChem CID | 58867084 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3-[4-(2-nitrophenyl)phenyl]urea |
| SMILES | CN(C)C1CCN(c2ccc(NC(=O)Nc3ccc(-c4ccccc4[N+](=O)[O-])cc3)cc2)C1 |
| InChI | InChI=1S/C25H27N5O3/c1-28(2)22-15-16-29(17-22)21-13-11-20(12-14-21)27-25(31)26-19-9-7-18(8-10-19)23-5-3-4-6-24(23)30(32)33/h3-14,22H,15-17H2,1-2H3,(H2,26,27,31) |
| InChIKey | WREPYOMBCOQQJL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|