C22H14F3NO4S — CID 58874718
2-[[4-[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]sulfamoyl]benzoic acid (PubChem CID 58874718) has the molecular formula C22H14F3NO4S and a molecular weight of 445.42 g/mol. Its IUPAC name is 2-[[4-[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]sulfamoyl]benzoic acid.
| Compound Name | 2-[[4-[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 58874718 |
| Molecular Formula | C22H14F3NO4S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 2-[[4-[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1S(=O)(=O)Nc1ccc(C#Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H14F3NO4S/c23-22(24,25)17-5-3-4-16(14-17)9-8-15-10-12-18(13-11-15)26-31(29,30)20-7-2-1-6-19(20)21(27)28/h1-7,10-14,26H,(H,27,28) |
| InChIKey | JWNSRWLZPOSPTC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|