C20H14F3NO6S — CID 175169240
2-hydroxy-4-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid (PubChem CID 175169240) has the molecular formula C20H14F3NO6S and a molecular weight of 453.39 g/mol. Its IUPAC name is 2-hydroxy-4-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-hydroxy-4-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 175169240 |
| Molecular Formula | C20H14F3NO6S |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 2-hydroxy-4-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2cc(C(F)(F)F)cc(-c3ccccc3)c2O)cc1O |
| InChI | InChI=1S/C20H14F3NO6S/c21-20(22,23)12-8-15(11-4-2-1-3-5-11)18(26)17(9-12)31(29,30)24-13-6-7-14(19(27)28)16(25)10-13/h1-10,24-26H,(H,27,28) |
| InChIKey | ZVCKFQOAYVPCDZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |