C23H18F3NO3S — CID 143133265
4-(1-hydroxyethyl)-N-[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]benzenesulfonamide (PubChem CID 143133265) has the molecular formula C23H18F3NO3S and a molecular weight of 445.46 g/mol. Its IUPAC name is 4-(1-hydroxyethyl)-N-[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]benzenesulfonamide.
| Compound Name | 4-(1-hydroxyethyl)-N-[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 143133265 |
| Molecular Formula | C23H18F3NO3S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 4-(1-hydroxyethyl)-N-[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]benzenesulfonamide |
| SMILES | CC(O)c1ccc(S(=O)(=O)Nc2cccc(C#Cc3cccc(C(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C23H18F3NO3S/c1-16(28)19-10-12-22(13-11-19)31(29,30)27-21-7-3-5-18(15-21)9-8-17-4-2-6-20(14-17)23(24,25)26/h2-7,10-16,27-28H,1H3 |
| InChIKey | DZBYFOQLRYILPG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|