C49H44N2 — CID 58881276
4-(9,9-dimethyl-4a,4b,8a,9a-tetrahydrofluoren-2-yl)-2-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]pyrimidine (PubChem CID 58881276) has the molecular formula C49H44N2 and a molecular weight of 660.91 g/mol. Its IUPAC name is 4-(9,9-dimethyl-4a,4b,8a,9a-tetrahydrofluoren-2-yl)-2-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]pyrimidine.
| Compound Name | 4-(9,9-dimethyl-4a,4b,8a,9a-tetrahydrofluoren-2-yl)-2-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]pyrimidine |
|---|---|
| PubChem CID | 58881276 |
| Molecular Formula | C49H44N2 |
| Molecular Weight | 660.91 g/mol |
| Exact Mass | 660.35 |
| IUPAC Name | 4-(9,9-dimethyl-4a,4b,8a,9a-tetrahydrofluoren-2-yl)-2-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]pyrimidine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(-c5nccc(C6=CC7C(C=C6)C6C=CC=CC6C7(C)C)n5)ccc3-4)cc21 |
| InChI | InChI=1S/C49H44N2/c1-47(2)39-13-9-7-11-33(39)35-19-15-29(25-41(35)47)30-16-20-37-38-22-18-32(28-44(38)49(5,6)42(37)26-30)46-50-24-23-45(51-46)31-17-21-36-34-12-8-10-14-40(34)48(3,4)43(36)27-31/h7-28,34,36,40,43H,1-6H3 |
| InChIKey | NXHIMAPQQMJCCX-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.91 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |