C32H54O4 — CID 58883773
2-[[2-(7-carboxyheptyl)-6-ethyl-5-hexylcyclohex-3-en-1-yl]methylidene]cyclooctane-1-carboxylic acid (PubChem CID 58883773) has the molecular formula C32H54O4 and a molecular weight of 502.78 g/mol. Its IUPAC name is 2-[[2-(7-carboxyheptyl)-6-ethyl-5-hexylcyclohex-3-en-1-yl]methylidene]cyclooctane-1-carboxylic acid.
| Compound Name | 2-[[2-(7-carboxyheptyl)-6-ethyl-5-hexylcyclohex-3-en-1-yl]methylidene]cyclooctane-1-carboxylic acid |
|---|---|
| PubChem CID | 58883773 |
| Molecular Formula | C32H54O4 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.40 |
| IUPAC Name | 2-[[2-(7-carboxyheptyl)-6-ethyl-5-hexylcyclohex-3-en-1-yl]methylidene]cyclooctane-1-carboxylic acid |
| SMILES | CCCCCCC1C=CC(CCCCCCCC(=O)O)C(C=C2CCCCCCC2C(=O)O)C1CC |
| InChI | InChI=1S/C32H54O4/c1-3-5-6-12-17-25-22-23-26(18-13-8-7-9-16-21-31(33)34)30(28(25)4-2)24-27-19-14-10-11-15-20-29(27)32(35)36/h22-26,28-30H,3-21H2,1-2H3,(H,33,34)(H,35,36) |
| InChIKey | OZJFITRYLDYVBA-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|