C22H44OSi — CID 58907924
[(1R,3aR,4S,7aR)-1-[(2S)-hexan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 58907924) has the molecular formula C22H44OSi and a molecular weight of 352.68 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(2S)-hexan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(2S)-hexan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 58907924 |
| Molecular Formula | C22H44OSi |
| Molecular Weight | 352.68 g/mol |
| Exact Mass | 352.32 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(2S)-hexan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCC[C@H](C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C22H44OSi/c1-9-10-12-17(2)18-14-15-19-20(13-11-16-22(18,19)6)23-24(7,8)21(3,4)5/h17-20H,9-16H2,1-8H3/t17-,18+,19-,20-,22+/m0/s1 |
| InChIKey | YYFRZPNTKIZYBS-UTNFEIGLSA-N |
| XLogP | 7.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.68 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|