About disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane
disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane (PubChem CID 58911368) has the molecular formula C2H4Na2O6S4
and a molecular weight of 298.30 g/mol. Its IUPAC name is disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane.
Molecular Properties
| Compound Name | disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane |
| PubChem CID | 58911368 |
| Molecular Formula | C2H4Na2O6S4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 297.87 |
| IUPAC Name | disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane |
| SMILES | O=S(=S)(CCS(=O)(=S)O[O-])O[O-].[Na+].[Na+] |
| InChI | InChI=1S/C2H6O6S4.2Na/c3-7-11(5,9)1-2-12(6,10)8-4;;/h3-4H,1-2H2;;/q;2*+1/p-2 |
| InChIKey | SNUJZGPPFKRXPA-UHFFFAOYSA-L |
| XLogP | -9.10 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane?
The IUPAC name of disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane (CID 58911368) is disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane.
What is the SMILES notation for disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane?
The canonical SMILES for disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane is O=S(=S)(CCS(=O)(=S)O[O-])O[O-].[Na+].[Na+].
What is the InChIKey of disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane?
The InChIKey is SNUJZGPPFKRXPA-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H6O6S4.2Na/c3-7-11(5,9)1-2-12(6,10)8-4;;/h3-4H,1-2H2;;/q;2*+1/p-2.
What are the key properties of disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane?
disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane has a molecular weight of 298.30 g/mol, XLogP of -9.10, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;oxidooxy-(2-oxidooxysulfonothioylethyl)-oxo-sulfanylidene-λ6-sulfane is sourced from PubChem (CID 58911368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).