C17H13F6NO2S — CID 58913313
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-oxo-2-thiophen-3-ylbutanamide (PubChem CID 58913313) has the molecular formula C17H13F6NO2S and a molecular weight of 409.35 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-oxo-2-thiophen-3-ylbutanamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-oxo-2-thiophen-3-ylbutanamide |
|---|---|
| PubChem CID | 58913313 |
| Molecular Formula | C17H13F6NO2S |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-oxo-2-thiophen-3-ylbutanamide |
| SMILES | O=CCC(C(=O)NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccsc1 |
| InChI | InChI=1S/C17H13F6NO2S/c18-16(19,20)12-5-10(6-13(7-12)17(21,22)23)8-24-15(26)14(1-3-25)11-2-4-27-9-11/h2-7,9,14H,1,8H2,(H,24,26) |
| InChIKey | ZFFLHOUCDMCFKK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|