C16H21FO3S — CID 58919192
(7R,8R,8aS)-6-ethylsulfanyl-8-fluoro-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 58919192) has the molecular formula C16H21FO3S and a molecular weight of 312.41 g/mol. Its IUPAC name is (7R,8R,8aS)-6-ethylsulfanyl-8-fluoro-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (7R,8R,8aS)-6-ethylsulfanyl-8-fluoro-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 58919192 |
| Molecular Formula | C16H21FO3S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (7R,8R,8aS)-6-ethylsulfanyl-8-fluoro-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CCSC1OC2COC(c3ccccc3)O[C@@H]2[C@H](F)[C@H]1C |
| InChI | InChI=1S/C16H21FO3S/c1-3-21-16-10(2)13(17)14-12(19-16)9-18-15(20-14)11-7-5-4-6-8-11/h4-8,10,12-16H,3,9H2,1-2H3/t10-,12?,13-,14+,15?,16?/m1/s1 |
| InChIKey | PATCMYPOPWQWEF-LRVRBEACSA-N |
| XLogP | 3.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |