C33H34ClF5N4O5 — CID 58920233
4-[[(1S,2R)-2-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]cyclohexanecarbonyl]amino]butanoic acid (PubChem CID 58920233) has the molecular formula C33H34ClF5N4O5 and a molecular weight of 697.10 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]cyclohexanecarbonyl]amino]butanoic acid.
| Compound Name | 4-[[(1S,2R)-2-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]cyclohexanecarbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 58920233 |
| Molecular Formula | C33H34ClF5N4O5 |
| Molecular Weight | 697.10 g/mol |
| Exact Mass | 696.21 |
| IUPAC Name | 4-[[(1S,2R)-2-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]cyclohexanecarbonyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)[C@H]1CCCC[C@H]1NC(=O)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C33H34ClF5N4O5/c34-22-12-13-27(41-19-22)32(18-20-7-2-1-3-8-20,21-15-23(35)17-24(16-21)48-33(38,39)30(36)37)43-31(47)42-26-10-5-4-9-25(26)29(46)40-14-6-11-28(44)45/h1-3,7-8,12-13,15-17,19,25-26,30H,4-6,9-11,14,18H2,(H,40,46)(H,44,45)(H2,42,43,47)/t25-,26+,32-/m0/s1 |
| InChIKey | NFDVWRAQKKARTN-BKQYKDOASA-N |
| XLogP | 6.44 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.10 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|