C24H36O3 — CID 58942424
1-[2-hydroxy-4-[5-(4-propylcyclohexyl)oxan-2-yl]phenyl]butan-1-one (PubChem CID 58942424) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is 1-[2-hydroxy-4-[5-(4-propylcyclohexyl)oxan-2-yl]phenyl]butan-1-one.
| Compound Name | 1-[2-hydroxy-4-[5-(4-propylcyclohexyl)oxan-2-yl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 58942424 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 1-[2-hydroxy-4-[5-(4-propylcyclohexyl)oxan-2-yl]phenyl]butan-1-one |
| SMILES | CCCC(=O)c1ccc(C2CCC(C3CCC(CCC)CC3)CO2)cc1O |
| InChI | InChI=1S/C24H36O3/c1-3-5-17-7-9-18(10-8-17)20-12-14-24(27-16-20)19-11-13-21(23(26)15-19)22(25)6-4-2/h11,13,15,17-18,20,24,26H,3-10,12,14,16H2,1-2H3 |
| InChIKey | DZRNCKZEPCRINF-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |