About methanidyl 2-methylbutanoate;2-methylpropane;yttrium
methanidyl 2-methylbutanoate;2-methylpropane;yttrium (PubChem CID 58944114) has the molecular formula C10H20O2Y-2
and a molecular weight of 261.17 g/mol. Its IUPAC name is methanidyl 2-methylbutanoate;2-methylpropane;yttrium.
Molecular Properties
| Compound Name | methanidyl 2-methylbutanoate;2-methylpropane;yttrium |
| PubChem CID | 58944114 |
| Molecular Formula | C10H20O2Y-2 |
| Molecular Weight | 261.17 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | methanidyl 2-methylbutanoate;2-methylpropane;yttrium |
| SMILES | C[C-](C)C.[CH2-]OC(=O)C(C)CC.[Y] |
| InChI | InChI=1S/C6H11O2.C4H9.Y/c1-4-5(2)6(7)8-3;1-4(2)3;/h5H,3-4H2,1-2H3;1-3H3;/q2*-1; |
| InChIKey | OGHMWMLTPRAVGT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methanidyl 2-methylbutanoate;2-methylpropane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanidyl 2-methylbutanoate;2-methylpropane;yttrium?
The IUPAC name of methanidyl 2-methylbutanoate;2-methylpropane;yttrium (CID 58944114) is methanidyl 2-methylbutanoate;2-methylpropane;yttrium.
What is the SMILES notation for methanidyl 2-methylbutanoate;2-methylpropane;yttrium?
The canonical SMILES for methanidyl 2-methylbutanoate;2-methylpropane;yttrium is C[C-](C)C.[CH2-]OC(=O)C(C)CC.[Y].
What is the InChIKey of methanidyl 2-methylbutanoate;2-methylpropane;yttrium?
The InChIKey is OGHMWMLTPRAVGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O2.C4H9.Y/c1-4-5(2)6(7)8-3;1-4(2)3;/h5H,3-4H2,1-2H3;1-3H3;/q2*-1;.
What are the key properties of methanidyl 2-methylbutanoate;2-methylpropane;yttrium?
methanidyl 2-methylbutanoate;2-methylpropane;yttrium has a molecular weight of 261.17 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanidyl 2-methylbutanoate;2-methylpropane;yttrium is sourced from PubChem (CID 58944114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).