C40H42F3N3O8S — CID 58947884
N-[3-[1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(methanesulfonamido)indol-3-yl]propyl]-2,2,2-trifluoroacetamide (PubChem CID 58947884) has the molecular formula C40H42F3N3O8S and a molecular weight of 781.85 g/mol. Its IUPAC name is N-[3-[1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(methanesulfonamido)indol-3-yl]propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(methanesulfonamido)indol-3-yl]propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 58947884 |
| Molecular Formula | C40H42F3N3O8S |
| Molecular Weight | 781.85 g/mol |
| Exact Mass | 781.26 |
| IUPAC Name | N-[3-[1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(methanesulfonamido)indol-3-yl]propyl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccc(C(OCC2OC(n3cc(CCCNC(=O)C(F)(F)F)c4cc(NS(C)(=O)=O)ccc43)CC2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H42F3N3O8S/c1-51-31-16-11-28(12-17-31)39(27-9-5-4-6-10-27,29-13-18-32(52-2)19-14-29)53-25-36-35(47)23-37(54-36)46-24-26(8-7-21-44-38(48)40(41,42)43)33-22-30(15-20-34(33)46)45-55(3,49)50/h4-6,9-20,22,24,35-37,45,47H,7-8,21,23,25H2,1-3H3,(H,44,48) |
| InChIKey | OPRXOKHLVSSPFU-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.85 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|