C23H26O6S — CID 58947999
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[2-(4-methoxyphenyl)ethyl]-1-benzothiophen-5-yl]oxane-3,4,5-triol (PubChem CID 58947999) has the molecular formula C23H26O6S and a molecular weight of 430.52 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[2-(4-methoxyphenyl)ethyl]-1-benzothiophen-5-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[2-(4-methoxyphenyl)ethyl]-1-benzothiophen-5-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58947999 |
| Molecular Formula | C23H26O6S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[2-(4-methoxyphenyl)ethyl]-1-benzothiophen-5-yl]oxane-3,4,5-triol |
| SMILES | COc1ccc(CCc2csc3ccc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc23)cc1 |
| InChI | InChI=1S/C23H26O6S/c1-28-16-7-3-13(4-8-16)2-5-15-12-30-19-9-6-14(10-17(15)19)23-22(27)21(26)20(25)18(11-24)29-23/h3-4,6-10,12,18,20-27H,2,5,11H2,1H3/t18-,20-,21+,22-,23+/m1/s1 |
| InChIKey | DBTXIEXLDPSVAQ-IFPLKCGESA-N |
| XLogP | 2.21 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |