C22H25NO6 — CID 58948010
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[1-[(4-methoxyphenyl)methyl]indol-6-yl]oxane-3,4,5-triol (PubChem CID 58948010) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[1-[(4-methoxyphenyl)methyl]indol-6-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[1-[(4-methoxyphenyl)methyl]indol-6-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58948010 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[1-[(4-methoxyphenyl)methyl]indol-6-yl]oxane-3,4,5-triol |
| SMILES | COc1ccc(Cn2ccc3ccc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc32)cc1 |
| InChI | InChI=1S/C22H25NO6/c1-28-16-6-2-13(3-7-16)11-23-9-8-14-4-5-15(10-17(14)23)22-21(27)20(26)19(25)18(12-24)29-22/h2-10,18-22,24-27H,11-12H2,1H3/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | LZGVMFBTUMXTPR-BDHVOXNPSA-N |
| XLogP | 1.21 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |