C21H22FNO5 — CID 58948007
(2S,3R,4R,5S,6R)-2-[1-[(4-fluorophenyl)methyl]indol-6-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 58948007) has the molecular formula C21H22FNO5 and a molecular weight of 387.41 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[1-[(4-fluorophenyl)methyl]indol-6-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[1-[(4-fluorophenyl)methyl]indol-6-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58948007 |
| Molecular Formula | C21H22FNO5 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[1-[(4-fluorophenyl)methyl]indol-6-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc3ccn(Cc4ccc(F)cc4)c3c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H22FNO5/c22-15-5-1-12(2-6-15)10-23-8-7-13-3-4-14(9-16(13)23)21-20(27)19(26)18(25)17(11-24)28-21/h1-9,17-21,24-27H,10-11H2/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | HZOZKWLBCOSLRS-ADAARDCZSA-N |
| XLogP | 1.34 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |