C24H29NO6 — CID 58948006
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[1-[(4-propan-2-yloxyphenyl)methyl]indol-6-yl]oxane-3,4,5-triol (PubChem CID 58948006) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[1-[(4-propan-2-yloxyphenyl)methyl]indol-6-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[1-[(4-propan-2-yloxyphenyl)methyl]indol-6-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58948006 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[1-[(4-propan-2-yloxyphenyl)methyl]indol-6-yl]oxane-3,4,5-triol |
| SMILES | CC(C)Oc1ccc(Cn2ccc3ccc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc32)cc1 |
| InChI | InChI=1S/C24H29NO6/c1-14(2)30-18-7-3-15(4-8-18)12-25-10-9-16-5-6-17(11-19(16)25)24-23(29)22(28)21(27)20(13-26)31-24/h3-11,14,20-24,26-29H,12-13H2,1-2H3/t20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | NDXWNGMMSOJVNO-SJSRKZJXSA-N |
| XLogP | 1.99 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |