C21H18Cl3NO — CID 58952358
(2E,4E)-N-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-5-(2,4-dichlorophenyl)-4-methylpenta-2,4-dienamide (PubChem CID 58952358) has the molecular formula C21H18Cl3NO and a molecular weight of 406.74 g/mol. Its IUPAC name is (2E,4E)-N-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-5-(2,4-dichlorophenyl)-4-methylpenta-2,4-dienamide.
| Compound Name | (2E,4E)-N-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-5-(2,4-dichlorophenyl)-4-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 58952358 |
| Molecular Formula | C21H18Cl3NO |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | (2E,4E)-N-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-5-(2,4-dichlorophenyl)-4-methylpenta-2,4-dienamide |
| SMILES | CC(/C=C/C(=O)NC/C=C\c1ccc(Cl)cc1)=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H18Cl3NO/c1-15(13-17-7-10-19(23)14-20(17)24)4-11-21(26)25-12-2-3-16-5-8-18(22)9-6-16/h2-11,13-14H,12H2,1H3,(H,25,26)/b3-2-,11-4+,15-13+ |
| InChIKey | NZMNXWHCMRELPF-ILCVBQTQSA-N |
| XLogP | 6.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|